About methylurea;urea
methylurea;urea (PubChem CID 20545500) has the molecular formula C3H10N4O2
and a molecular weight of 134.14 g/mol. Its IUPAC name is methylurea;urea.
Molecular Properties
| Compound Name | methylurea;urea |
| PubChem CID | 20545500 |
| Molecular Formula | C3H10N4O2 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | methylurea;urea |
| SMILES | CNC(N)=O.NC(N)=O |
| InChI | InChI=1S/C2H6N2O.CH4N2O/c1-4-2(3)5;2-1(3)4/h1H3,(H3,3,4,5);(H4,2,3,4) |
| InChIKey | ZWISJRCLMTZJIA-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methylurea;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylurea;urea?
The IUPAC name of methylurea;urea (CID 20545500) is methylurea;urea.
What is the SMILES notation for methylurea;urea?
The canonical SMILES for methylurea;urea is CNC(N)=O.NC(N)=O.
What is the InChIKey of methylurea;urea?
The InChIKey is ZWISJRCLMTZJIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.CH4N2O/c1-4-2(3)5;2-1(3)4/h1H3,(H3,3,4,5);(H4,2,3,4).
What are the key properties of methylurea;urea?
methylurea;urea has a molecular weight of 134.14 g/mol, XLogP of -1.69, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylurea;urea is sourced from PubChem (CID 20545500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).