C8H22Cl2N2 — CID 20545505
N,N,N',N'-tetramethylbutane-1,4-diamine;dihydrochloride (PubChem CID 20545505) has the molecular formula C8H22Cl2N2 and a molecular weight of 217.18 g/mol. Its IUPAC name is N,N,N',N'-tetramethylbutane-1,4-diamine;dihydrochloride.
| Compound Name | N,N,N',N'-tetramethylbutane-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 20545505 |
| Molecular Formula | C8H22Cl2N2 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | N,N,N',N'-tetramethylbutane-1,4-diamine;dihydrochloride |
| SMILES | CN(C)CCCCN(C)C.Cl.Cl |
| InChI | InChI=1S/C8H20N2.2ClH/c1-9(2)7-5-6-8-10(3)4;;/h5-8H2,1-4H3;2*1H |
| InChIKey | KUFSMRWXZRFVNM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|