About 1-hydroxypropyl sulfite
1-hydroxypropyl sulfite (PubChem CID 20545655) has the molecular formula C3H7O4S-
and a molecular weight of 139.15 g/mol. Its IUPAC name is 1-hydroxypropyl sulfite.
Molecular Properties
| Compound Name | 1-hydroxypropyl sulfite |
| PubChem CID | 20545655 |
| Molecular Formula | C3H7O4S- |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.01 |
| IUPAC Name | 1-hydroxypropyl sulfite |
| SMILES | CCC(O)OS(=O)[O-] |
| InChI | InChI=1S/C3H8O4S/c1-2-3(4)7-8(5)6/h3-4H,2H2,1H3,(H,5,6)/p-1 |
| InChIKey | YRIYHFOAMLGMRL-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypropyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropyl sulfite?
The IUPAC name of 1-hydroxypropyl sulfite (CID 20545655) is 1-hydroxypropyl sulfite.
What is the SMILES notation for 1-hydroxypropyl sulfite?
The canonical SMILES for 1-hydroxypropyl sulfite is CCC(O)OS(=O)[O-].
What is the InChIKey of 1-hydroxypropyl sulfite?
The InChIKey is YRIYHFOAMLGMRL-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H8O4S/c1-2-3(4)7-8(5)6/h3-4H,2H2,1H3,(H,5,6)/p-1.
What are the key properties of 1-hydroxypropyl sulfite?
1-hydroxypropyl sulfite has a molecular weight of 139.15 g/mol, XLogP of -0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropyl sulfite is sourced from PubChem (CID 20545655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).