About 2,3,4,5-tetramethylpyrrolidine
2,3,4,5-tetramethylpyrrolidine (PubChem CID 20546029) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is 2,3,4,5-tetramethylpyrrolidine.
Molecular Properties
| Compound Name | 2,3,4,5-tetramethylpyrrolidine |
| PubChem CID | 20546029 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | 2,3,4,5-tetramethylpyrrolidine |
| SMILES | CC1NC(C)C(C)C1C |
| InChI | InChI=1S/C8H17N/c1-5-6(2)8(4)9-7(5)3/h5-9H,1-4H3 |
| InChIKey | OILCKFMEPIHVTL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4,5-tetramethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetramethylpyrrolidine?
The IUPAC name of 2,3,4,5-tetramethylpyrrolidine (CID 20546029) is 2,3,4,5-tetramethylpyrrolidine.
What is the SMILES notation for 2,3,4,5-tetramethylpyrrolidine?
The canonical SMILES for 2,3,4,5-tetramethylpyrrolidine is CC1NC(C)C(C)C1C.
What is the InChIKey of 2,3,4,5-tetramethylpyrrolidine?
The InChIKey is OILCKFMEPIHVTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N/c1-5-6(2)8(4)9-7(5)3/h5-9H,1-4H3.
What are the key properties of 2,3,4,5-tetramethylpyrrolidine?
2,3,4,5-tetramethylpyrrolidine has a molecular weight of 127.23 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetramethylpyrrolidine is sourced from PubChem (CID 20546029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).