About 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine
1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine (PubChem CID 20546232) has the molecular formula C12H13F3N2
and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine.
Molecular Properties
| Compound Name | 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine |
| PubChem CID | 20546232 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine |
| SMILES | CN1C=NCC(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H13F3N2/c1-17-7-10(6-16-8-17)9-3-2-4-11(5-9)12(13,14)15/h2-5,8,10H,6-7H2,1H3 |
| InChIKey | CKTCCPWRVBROEB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine?
The IUPAC name of 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine (CID 20546232) is 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine.
What is the SMILES notation for 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine?
The canonical SMILES for 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine is CN1C=NCC(c2cccc(C(F)(F)F)c2)C1.
What is the InChIKey of 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine?
The InChIKey is CKTCCPWRVBROEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N2/c1-17-7-10(6-16-8-17)9-3-2-4-11(5-9)12(13,14)15/h2-5,8,10H,6-7H2,1H3.
What are the key properties of 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine?
1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine has a molecular weight of 242.24 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-[3-(trifluoromethyl)phenyl]-5,6-dihydro-4H-pyrimidine is sourced from PubChem (CID 20546232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).