About 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine
2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine (PubChem CID 20546284) has the molecular formula C10H14F2N2
and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine |
| PubChem CID | 20546284 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine |
| SMILES | CNCC(CN)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H14F2N2/c1-14-6-8(5-13)7-2-9(11)4-10(12)3-7/h2-4,8,14H,5-6,13H2,1H3 |
| InChIKey | ANCLGXUHOKIXLU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine?
The IUPAC name of 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine (CID 20546284) is 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine?
The canonical SMILES for 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine is CNCC(CN)c1cc(F)cc(F)c1.
What is the InChIKey of 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine?
The InChIKey is ANCLGXUHOKIXLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2/c1-14-6-8(5-13)7-2-9(11)4-10(12)3-7/h2-4,8,14H,5-6,13H2,1H3.
What are the key properties of 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine?
2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine has a molecular weight of 200.23 g/mol, XLogP of 1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 20546284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).