About 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine
2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine (PubChem CID 20546338) has the molecular formula C10H15FN2
and a molecular weight of 182.24 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine |
| PubChem CID | 20546338 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine |
| SMILES | CNCC(CN)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H15FN2/c1-13-7-9(6-12)8-2-4-10(11)5-3-8/h2-5,9,13H,6-7,12H2,1H3 |
| InChIKey | BWJMSJHVAJKRQA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine?
The IUPAC name of 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine (CID 20546338) is 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine?
The canonical SMILES for 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine is CNCC(CN)c1ccc(F)cc1.
What is the InChIKey of 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine?
The InChIKey is BWJMSJHVAJKRQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2/c1-13-7-9(6-12)8-2-4-10(11)5-3-8/h2-5,9,13H,6-7,12H2,1H3.
What are the key properties of 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine?
2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine has a molecular weight of 182.24 g/mol, XLogP of 1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 20546338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).