About 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine
2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine (PubChem CID 20546354) has the molecular formula C12H20N2O2S2
and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine |
| PubChem CID | 20546354 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine |
| SMILES | CNCC(CN)c1c(S(C)=O)cccc1S(C)=O |
| InChI | InChI=1S/C12H20N2O2S2/c1-14-8-9(7-13)12-10(17(2)15)5-4-6-11(12)18(3)16/h4-6,9,14H,7-8,13H2,1-3H3 |
| InChIKey | YKNKBNGWPZZNOL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine?
The IUPAC name of 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine (CID 20546354) is 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine.
What is the SMILES notation for 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine?
The canonical SMILES for 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine is CNCC(CN)c1c(S(C)=O)cccc1S(C)=O.
What is the InChIKey of 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine?
The InChIKey is YKNKBNGWPZZNOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2S2/c1-14-8-9(7-13)12-10(17(2)15)5-4-6-11(12)18(3)16/h4-6,9,14H,7-8,13H2,1-3H3.
What are the key properties of 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine?
2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine has a molecular weight of 288.44 g/mol, XLogP of 0.42, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-bis(methylsulfinyl)phenyl]-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 20546354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).