C10H11Cl2N3 — CID 20546570
5-(2,5-dichlorophenyl)-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 20546570) has the molecular formula C10H11Cl2N3 and a molecular weight of 244.12 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | 5-(2,5-dichlorophenyl)-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 20546570 |
| Molecular Formula | C10H11Cl2N3 |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 5-(2,5-dichlorophenyl)-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | NC1=NCC(c2cc(Cl)ccc2Cl)CN1 |
| InChI | InChI=1S/C10H11Cl2N3/c11-7-1-2-9(12)8(3-7)6-4-14-10(13)15-5-6/h1-3,6H,4-5H2,(H3,13,14,15) |
| InChIKey | HKJJBXPRQSTQFZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |