C10H11NO — CID 20546924
5,7,8,9-tetrahydrocyclohepta[c]pyridin-6-one (PubChem CID 20546924) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 5,7,8,9-tetrahydrocyclohepta[c]pyridin-6-one.
| Compound Name | 5,7,8,9-tetrahydrocyclohepta[c]pyridin-6-one |
|---|---|
| PubChem CID | 20546924 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 5,7,8,9-tetrahydrocyclohepta[c]pyridin-6-one |
| SMILES | O=C1CCCc2cnccc2C1 |
| InChI | InChI=1S/C10H11NO/c12-10-3-1-2-9-7-11-5-4-8(9)6-10/h4-5,7H,1-3,6H2 |
| InChIKey | LBIXCWGPVISDTA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |