C7H8ClF3O2 — CID 20546958
5-chloro-1,1,1-trifluoroheptane-2,4-dione (PubChem CID 20546958) has the molecular formula C7H8ClF3O2 and a molecular weight of 216.59 g/mol. Its IUPAC name is 5-chloro-1,1,1-trifluoroheptane-2,4-dione.
| Compound Name | 5-chloro-1,1,1-trifluoroheptane-2,4-dione |
|---|---|
| PubChem CID | 20546958 |
| Molecular Formula | C7H8ClF3O2 |
| Molecular Weight | 216.59 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 5-chloro-1,1,1-trifluoroheptane-2,4-dione |
| SMILES | CCC(Cl)C(=O)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H8ClF3O2/c1-2-4(8)5(12)3-6(13)7(9,10)11/h4H,2-3H2,1H3 |
| InChIKey | XFGVQERULXXBKR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|