C20H42N4 — CID 20547115
1-N,1-N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,1-diamine (PubChem CID 20547115) has the molecular formula C20H42N4 and a molecular weight of 338.58 g/mol. Its IUPAC name is 1-N,1-N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 20547115 |
| Molecular Formula | C20H42N4 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.34 |
| IUPAC Name | 1-N,1-N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,1-diamine |
| SMILES | CC(NC1CC(C)(C)NC(C)(C)C1)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H42N4/c1-14(21-15-10-17(2,3)23-18(4,5)11-15)22-16-12-19(6,7)24-20(8,9)13-16/h14-16,21-24H,10-13H2,1-9H3 |
| InChIKey | WDOUYFQMSNLQGE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|