C21H43N4OP — CID 20547116
2-methyl-1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,2λ5-diazaphospholidine 2-oxide (PubChem CID 20547116) has the molecular formula C21H43N4OP and a molecular weight of 398.58 g/mol. Its IUPAC name is 2-methyl-1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,2λ5-diazaphospholidine 2-oxide.
| Compound Name | 2-methyl-1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,2λ5-diazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 20547116 |
| Molecular Formula | C21H43N4OP |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | 2-methyl-1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,2λ5-diazaphospholidine 2-oxide |
| SMILES | CC1(C)CC(N2CCN(C3CC(C)(C)NC(C)(C)C3)P2(C)=O)CC(C)(C)N1 |
| InChI | InChI=1S/C21H43N4OP/c1-18(2)12-16(13-19(3,4)22-18)24-10-11-25(27(24,9)26)17-14-20(5,6)23-21(7,8)15-17/h16-17,22-23H,10-15H2,1-9H3 |
| InChIKey | BHHXAGOQSBRXPZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|