C24H50O4 — CID 20547385
2,5-bis(2,2-dimethylhexan-3-ylperoxy)-2,5-dimethylhexane (PubChem CID 20547385) has the molecular formula C24H50O4 and a molecular weight of 402.66 g/mol. Its IUPAC name is 2,5-bis(2,2-dimethylhexan-3-ylperoxy)-2,5-dimethylhexane.
| Compound Name | 2,5-bis(2,2-dimethylhexan-3-ylperoxy)-2,5-dimethylhexane |
|---|---|
| PubChem CID | 20547385 |
| Molecular Formula | C24H50O4 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | 2,5-bis(2,2-dimethylhexan-3-ylperoxy)-2,5-dimethylhexane |
| SMILES | CCCC(OOC(C)(C)CCC(C)(C)OOC(CCC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H50O4/c1-13-15-19(21(3,4)5)25-27-23(9,10)17-18-24(11,12)28-26-20(16-14-2)22(6,7)8/h19-20H,13-18H2,1-12H3 |
| InChIKey | QHTSDRNRHRCUAQ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|