C22H32N2O3 — CID 20548022
1-[2-[2-[(4-butoxyphenyl)methyl]-5,5-dimethyl-1,3-dioxan-2-yl]ethyl]imidazole (PubChem CID 20548022) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-[2-[2-[(4-butoxyphenyl)methyl]-5,5-dimethyl-1,3-dioxan-2-yl]ethyl]imidazole.
| Compound Name | 1-[2-[2-[(4-butoxyphenyl)methyl]-5,5-dimethyl-1,3-dioxan-2-yl]ethyl]imidazole |
|---|---|
| PubChem CID | 20548022 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 1-[2-[2-[(4-butoxyphenyl)methyl]-5,5-dimethyl-1,3-dioxan-2-yl]ethyl]imidazole |
| SMILES | CCCCOc1ccc(CC2(CCn3ccnc3)OCC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C22H32N2O3/c1-4-5-14-25-20-8-6-19(7-9-20)15-22(10-12-24-13-11-23-18-24)26-16-21(2,3)17-27-22/h6-9,11,13,18H,4-5,10,12,14-17H2,1-3H3 |
| InChIKey | YXSXVMZQPGAWHV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|