C14H10Cl3NO2 — CID 20548496
3-(3-chlorophenyl)-5-(2,2-dichloroacetyl)-1-methylpyridin-4-one (PubChem CID 20548496) has the molecular formula C14H10Cl3NO2 and a molecular weight of 330.60 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-(2,2-dichloroacetyl)-1-methylpyridin-4-one.
| Compound Name | 3-(3-chlorophenyl)-5-(2,2-dichloroacetyl)-1-methylpyridin-4-one |
|---|---|
| PubChem CID | 20548496 |
| Molecular Formula | C14H10Cl3NO2 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 3-(3-chlorophenyl)-5-(2,2-dichloroacetyl)-1-methylpyridin-4-one |
| SMILES | Cn1cc(C(=O)C(Cl)Cl)c(=O)c(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C14H10Cl3NO2/c1-18-6-10(8-3-2-4-9(15)5-8)12(19)11(7-18)13(20)14(16)17/h2-7,14H,1H3 |
| InChIKey | ULKDZJHMNDKZTJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|