About 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate
4,6-dimethyl-1H-pyrimidin-2-one;dihydrate (PubChem CID 20548799) has the molecular formula C6H12N2O3
and a molecular weight of 160.17 g/mol. Its IUPAC name is 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate.
Molecular Properties
| Compound Name | 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate |
| PubChem CID | 20548799 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate |
| SMILES | Cc1cc(C)[nH]c(=O)n1.O.O |
| InChI | InChI=1S/C6H8N2O.2H2O/c1-4-3-5(2)8-6(9)7-4;;/h3H,1-2H3,(H,7,8,9);2*1H2 |
| InChIKey | PHZRQHNAFBQCPL-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate?
The IUPAC name of 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate (CID 20548799) is 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate.
What is the SMILES notation for 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate?
The canonical SMILES for 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate is Cc1cc(C)[nH]c(=O)n1.O.O.
What is the InChIKey of 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate?
The InChIKey is PHZRQHNAFBQCPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O.2H2O/c1-4-3-5(2)8-6(9)7-4;;/h3H,1-2H3,(H,7,8,9);2*1H2.
What are the key properties of 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate?
4,6-dimethyl-1H-pyrimidin-2-one;dihydrate has a molecular weight of 160.17 g/mol, XLogP of -1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-1H-pyrimidin-2-one;dihydrate is sourced from PubChem (CID 20548799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).