C10H9F4N3O3 — CID 20549012
1,3-bis(3,3-difluoroprop-2-enyl)-5-methyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 20549012) has the molecular formula C10H9F4N3O3 and a molecular weight of 295.19 g/mol. Its IUPAC name is 1,3-bis(3,3-difluoroprop-2-enyl)-5-methyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(3,3-difluoroprop-2-enyl)-5-methyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 20549012 |
| Molecular Formula | C10H9F4N3O3 |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 1,3-bis(3,3-difluoroprop-2-enyl)-5-methyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)n(CC=C(F)F)c(=O)n(CC=C(F)F)c1=O |
| InChI | InChI=1S/C10H9F4N3O3/c1-15-8(18)16(4-2-6(11)12)10(20)17(9(15)19)5-3-7(13)14/h2-3H,4-5H2,1H3 |
| InChIKey | DYIUHNDFOOYJAL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |