C9H7F4N3O3 — CID 20549013
1,3-bis(3,3-difluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 20549013) has the molecular formula C9H7F4N3O3 and a molecular weight of 281.17 g/mol. Its IUPAC name is 1,3-bis(3,3-difluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(3,3-difluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 20549013 |
| Molecular Formula | C9H7F4N3O3 |
| Molecular Weight | 281.17 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1,3-bis(3,3-difluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CC=C(F)F)c(=O)n1CC=C(F)F |
| InChI | InChI=1S/C9H7F4N3O3/c10-5(11)1-3-15-7(17)14-8(18)16(9(15)19)4-2-6(12)13/h1-2H,3-4H2,(H,14,17,18) |
| InChIKey | YPRKKXLRULJNQD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |