C22H25N3O2S — CID 20549284
3-methylsulfanyl-5,6-bis(4-propan-2-yloxyphenyl)-1,2,4-triazine (PubChem CID 20549284) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 3-methylsulfanyl-5,6-bis(4-propan-2-yloxyphenyl)-1,2,4-triazine.
| Compound Name | 3-methylsulfanyl-5,6-bis(4-propan-2-yloxyphenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 20549284 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-methylsulfanyl-5,6-bis(4-propan-2-yloxyphenyl)-1,2,4-triazine |
| SMILES | CSc1nnc(-c2ccc(OC(C)C)cc2)c(-c2ccc(OC(C)C)cc2)n1 |
| InChI | InChI=1S/C22H25N3O2S/c1-14(2)26-18-10-6-16(7-11-18)20-21(24-25-22(23-20)28-5)17-8-12-19(13-9-17)27-15(3)4/h6-15H,1-5H3 |
| InChIKey | ARELCRQGOORHSB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |