C17H30BrF5 — CID 20549339
17-bromo-1,1,1,7,7-pentafluoroheptadecane (PubChem CID 20549339) has the molecular formula C17H30BrF5 and a molecular weight of 409.32 g/mol. Its IUPAC name is 17-bromo-1,1,1,7,7-pentafluoroheptadecane.
| Compound Name | 17-bromo-1,1,1,7,7-pentafluoroheptadecane |
|---|---|
| PubChem CID | 20549339 |
| Molecular Formula | C17H30BrF5 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 17-bromo-1,1,1,7,7-pentafluoroheptadecane |
| SMILES | FC(F)(F)CCCCCC(F)(F)CCCCCCCCCCBr |
| InChI | InChI=1S/C17H30BrF5/c18-15-11-6-4-2-1-3-5-8-12-16(19,20)13-9-7-10-14-17(21,22)23/h1-15H2 |
| InChIKey | CWRSRYLXAPNPLF-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|