C15H8F15NO2 — CID 20549376
4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)benzoic acid (PubChem CID 20549376) has the molecular formula C15H8F15NO2 and a molecular weight of 519.20 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)benzoic acid.
| Compound Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)benzoic acid |
|---|---|
| PubChem CID | 20549376 |
| Molecular Formula | C15H8F15NO2 |
| Molecular Weight | 519.20 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H8F15NO2/c16-9(17,5-31-7-3-1-6(2-4-7)8(32)33)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30/h1-4,31H,5H2,(H,32,33) |
| InChIKey | RUESXSNSDAABBG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.20 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|