About 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine
2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine (PubChem CID 20549608) has the molecular formula C18H34S2
and a molecular weight of 314.60 g/mol. Its IUPAC name is 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine.
Molecular Properties
| Compound Name | 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine |
| PubChem CID | 20549608 |
| Molecular Formula | C18H34S2 |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine |
| SMILES | CCCCCCC1=C(CCCCCC)SC(CC)CS1 |
| InChI | InChI=1S/C18H34S2/c1-4-7-9-11-13-17-18(14-12-10-8-5-2)20-16(6-3)15-19-17/h16H,4-15H2,1-3H3 |
| InChIKey | APGUDOQSOOOBAF-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine?
The IUPAC name of 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine (CID 20549608) is 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine.
What is the SMILES notation for 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine?
The canonical SMILES for 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine is CCCCCCC1=C(CCCCCC)SC(CC)CS1.
What is the InChIKey of 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine?
The InChIKey is APGUDOQSOOOBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34S2/c1-4-7-9-11-13-17-18(14-12-10-8-5-2)20-16(6-3)15-19-17/h16H,4-15H2,1-3H3.
What are the key properties of 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine?
2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine has a molecular weight of 314.60 g/mol, XLogP of 7.40, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,6-dihexyl-2,3-dihydro-1,4-dithiine is sourced from PubChem (CID 20549608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).