C19H16ClF3N4O2 — CID 2054974
15-chloro-N-(2-methoxyethyl)-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene-14-carboxamide (PubChem CID 2054974) has the molecular formula C19H16ClF3N4O2 and a molecular weight of 424.81 g/mol. Its IUPAC name is 15-chloro-N-(2-methoxyethyl)-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene-14-carboxamide.
| Compound Name | 15-chloro-N-(2-methoxyethyl)-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene-14-carboxamide |
|---|---|
| PubChem CID | 2054974 |
| Molecular Formula | C19H16ClF3N4O2 |
| Molecular Weight | 424.81 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 15-chloro-N-(2-methoxyethyl)-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene-14-carboxamide |
| SMILES | COCCNC(=O)c1nn2c(C(F)(F)F)c3c(nc2c1Cl)-c1ccccc1CC3 |
| InChI | InChI=1S/C19H16ClF3N4O2/c1-29-9-8-24-18(28)15-13(20)17-25-14-11-5-3-2-4-10(11)6-7-12(14)16(19(21,22)23)27(17)26-15/h2-5H,6-9H2,1H3,(H,24,28) |
| InChIKey | QPEHKAQNWBRFQR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.81 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|