C10H16N4O3S — CID 20550144
(Z)-1-N-methyl-2-nitro-1-N'-[3-(1,2-oxazol-3-ylmethylsulfanyl)propyl]ethene-1,1-diamine (PubChem CID 20550144) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is (Z)-1-N-methyl-2-nitro-1-N'-[3-(1,2-oxazol-3-ylmethylsulfanyl)propyl]ethene-1,1-diamine.
| Compound Name | (Z)-1-N-methyl-2-nitro-1-N'-[3-(1,2-oxazol-3-ylmethylsulfanyl)propyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 20550144 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (Z)-1-N-methyl-2-nitro-1-N'-[3-(1,2-oxazol-3-ylmethylsulfanyl)propyl]ethene-1,1-diamine |
| SMILES | CN/C(=C/[N+](=O)[O-])NCCCSCc1ccon1 |
| InChI | InChI=1S/C10H16N4O3S/c1-11-10(7-14(15)16)12-4-2-6-18-8-9-3-5-17-13-9/h3,5,7,11-12H,2,4,6,8H2,1H3/b10-7- |
| InChIKey | AHKWKYVSXDQXQT-YFHOEESVSA-N |
| XLogP | 1.18 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|