C15H22N6O2S3 — CID 20550146
(Z)-1-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-1-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine (PubChem CID 20550146) has the molecular formula C15H22N6O2S3 and a molecular weight of 414.58 g/mol. Its IUPAC name is (Z)-1-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-1-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine.
| Compound Name | (Z)-1-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-1-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 20550146 |
| Molecular Formula | C15H22N6O2S3 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (Z)-1-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-1-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine |
| SMILES | Cc1[nH]cnc1CSCCN/C(=C/[N+](=O)[O-])NCCSCc1nccs1 |
| InChI | InChI=1S/C15H22N6O2S3/c1-12-13(20-11-19-12)9-24-5-2-16-14(8-21(22)23)17-3-6-25-10-15-18-4-7-26-15/h4,7-8,11,16-17H,2-3,5-6,9-10H2,1H3,(H,19,20)/b14-8- |
| InChIKey | YXGKKTZNPQTLOW-ZSOIEALJSA-N |
| XLogP | 2.60 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|