C9H14N4O3S — CID 20550195
(Z)-1-N-methyl-2-nitro-1-N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]ethene-1,1-diamine (PubChem CID 20550195) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is (Z)-1-N-methyl-2-nitro-1-N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]ethene-1,1-diamine.
| Compound Name | (Z)-1-N-methyl-2-nitro-1-N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 20550195 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (Z)-1-N-methyl-2-nitro-1-N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]ethene-1,1-diamine |
| SMILES | CN/C(=C/[N+](=O)[O-])NCCSCc1ccon1 |
| InChI | InChI=1S/C9H14N4O3S/c1-10-9(6-13(14)15)11-3-5-17-7-8-2-4-16-12-8/h2,4,6,10-11H,3,5,7H2,1H3/b9-6- |
| InChIKey | ANMJKWMCGRPRCR-TWGQIWQCSA-N |
| XLogP | 0.79 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|