About 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile
2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile (PubChem CID 20550206) has the molecular formula C11H13N5OS
and a molecular weight of 263.33 g/mol. Its IUPAC name is 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile |
| PubChem CID | 20550206 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile |
| SMILES | CNC(NCCSCc1ccon1)=C(C#N)C#N |
| InChI | InChI=1S/C11H13N5OS/c1-14-11(9(6-12)7-13)15-3-5-18-8-10-2-4-17-16-10/h2,4,14-15H,3,5,8H2,1H3 |
| InChIKey | XEVSQMHFQQNCHX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 97.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile?
The IUPAC name of 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile (CID 20550206) is 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile.
What is the SMILES notation for 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile?
The canonical SMILES for 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile is CNC(NCCSCc1ccon1)=C(C#N)C#N.
What is the InChIKey of 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile?
The InChIKey is XEVSQMHFQQNCHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5OS/c1-14-11(9(6-12)7-13)15-3-5-18-8-10-2-4-17-16-10/h2,4,14-15H,3,5,8H2,1H3.
What are the key properties of 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile?
2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile has a molecular weight of 263.33 g/mol, XLogP of 0.98, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methylamino-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethylamino]methylidene]propanedinitrile is sourced from PubChem (CID 20550206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).