C13H12N4S — CID 20550300
5-(3,5-dimethyl-4-pyridinyl)-1,3-dihydroimidazo[4,5-b]pyridine-2-thione (PubChem CID 20550300) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 5-(3,5-dimethyl-4-pyridinyl)-1,3-dihydroimidazo[4,5-b]pyridine-2-thione.
| Compound Name | 5-(3,5-dimethyl-4-pyridinyl)-1,3-dihydroimidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 20550300 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 5-(3,5-dimethyl-4-pyridinyl)-1,3-dihydroimidazo[4,5-b]pyridine-2-thione |
| SMILES | Cc1cncc(C)c1-c1ccc2[nH]c(=S)[nH]c2n1 |
| InChI | InChI=1S/C13H12N4S/c1-7-5-14-6-8(2)11(7)9-3-4-10-12(15-9)17-13(18)16-10/h3-6H,1-2H3,(H2,15,16,17,18) |
| InChIKey | XUVBJGCAUWBJDY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|