C12H18N2O2 — CID 2055081
3-pentyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione (PubChem CID 2055081) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-pentyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione.
| Compound Name | 3-pentyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2055081 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-pentyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione |
| SMILES | CCCCCn1c(=O)[nH]c2c(c1=O)CCC2 |
| InChI | InChI=1S/C12H18N2O2/c1-2-3-4-8-14-11(15)9-6-5-7-10(9)13-12(14)16/h2-8H2,1H3,(H,13,16) |
| InChIKey | PANQLXVBDRZFBB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|