C17H22N2O3S — CID 20550956
5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]thiophene-3-carboxamide (PubChem CID 20550956) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]thiophene-3-carboxamide.
| Compound Name | 5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 20550956 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]thiophene-3-carboxamide |
| SMILES | COc1ccc(CC(C)NCC(O)c2cc(C(N)=O)cs2)cc1 |
| InChI | InChI=1S/C17H22N2O3S/c1-11(7-12-3-5-14(22-2)6-4-12)19-9-15(20)16-8-13(10-23-16)17(18)21/h3-6,8,10-11,15,19-20H,7,9H2,1-2H3,(H2,18,21) |
| InChIKey | CNSNRLKKKDVAPH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |