C19H25N3O5S2 — CID 2055104
6-N,8-N-dibutyl-2-oxo-1H-benzo[cd]indole-6,8-disulfonamide (PubChem CID 2055104) has the molecular formula C19H25N3O5S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 6-N,8-N-dibutyl-2-oxo-1H-benzo[cd]indole-6,8-disulfonamide.
| Compound Name | 6-N,8-N-dibutyl-2-oxo-1H-benzo[cd]indole-6,8-disulfonamide |
|---|---|
| PubChem CID | 2055104 |
| Molecular Formula | C19H25N3O5S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 6-N,8-N-dibutyl-2-oxo-1H-benzo[cd]indole-6,8-disulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cc(S(=O)(=O)NCCCC)c2cccc3c2c1NC3=O |
| InChI | InChI=1S/C19H25N3O5S2/c1-3-5-10-20-28(24,25)15-12-16(29(26,27)21-11-6-4-2)18-17-13(15)8-7-9-14(17)19(23)22-18/h7-9,12,20-21H,3-6,10-11H2,1-2H3,(H,22,23) |
| InChIKey | MTKIMUSRLQRERS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|