About sodium N,N-diethylaniline
sodium N,N-diethylaniline (PubChem CID 20551492) has the molecular formula C10H14NNa
and a molecular weight of 171.22 g/mol. Its IUPAC name is sodium N,N-diethylaniline.
Molecular Properties
| Compound Name | sodium N,N-diethylaniline |
| PubChem CID | 20551492 |
| Molecular Formula | C10H14NNa |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | sodium N,N-diethylaniline |
| SMILES | CCN(CC)c1cc[c-]cc1.[Na+] |
| InChI | InChI=1S/C10H14N.Na/c1-3-11(4-2)10-8-6-5-7-9-10;/h6-9H,3-4H2,1-2H3;/q-1;+1 |
| InChIKey | VVEHKOIIGNGNIZ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N,N-diethylaniline?
The IUPAC name of sodium N,N-diethylaniline (CID 20551492) is sodium N,N-diethylaniline.
What is the SMILES notation for sodium N,N-diethylaniline?
The canonical SMILES for sodium N,N-diethylaniline is CCN(CC)c1cc[c-]cc1.[Na+].
What is the InChIKey of sodium N,N-diethylaniline?
The InChIKey is VVEHKOIIGNGNIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N.Na/c1-3-11(4-2)10-8-6-5-7-9-10;/h6-9H,3-4H2,1-2H3;/q-1;+1.
What are the key properties of sodium N,N-diethylaniline?
sodium N,N-diethylaniline has a molecular weight of 171.22 g/mol, XLogP of -0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N,N-diethylaniline is sourced from PubChem (CID 20551492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).