C12H3BrClF9N2 — CID 20551778
4-bromo-2-[2-chloro-6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-(trifluoromethyl)-1H-imidazole (PubChem CID 20551778) has the molecular formula C12H3BrClF9N2 and a molecular weight of 461.51 g/mol. Its IUPAC name is 4-bromo-2-[2-chloro-6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-(trifluoromethyl)-1H-imidazole.
| Compound Name | 4-bromo-2-[2-chloro-6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 20551778 |
| Molecular Formula | C12H3BrClF9N2 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 459.90 |
| IUPAC Name | 4-bromo-2-[2-chloro-6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-(trifluoromethyl)-1H-imidazole |
| SMILES | Fc1cc(C(F)(F)C(F)(F)F)cc(Cl)c1-c1nc(Br)c(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C12H3BrClF9N2/c13-8-7(11(18,19)20)24-9(25-8)6-4(14)1-3(2-5(6)15)10(16,17)12(21,22)23/h1-2H,(H,24,25) |
| InChIKey | XKLPGVSUGWWKEL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|