About ethyl (E)-7,7,7-triethoxyhept-5-enoate
ethyl (E)-7,7,7-triethoxyhept-5-enoate (PubChem CID 20552418) has the molecular formula C15H28O5
and a molecular weight of 288.38 g/mol. Its IUPAC name is ethyl (E)-7,7,7-triethoxyhept-5-enoate.
Molecular Properties
| Compound Name | ethyl (E)-7,7,7-triethoxyhept-5-enoate |
| PubChem CID | 20552418 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | ethyl (E)-7,7,7-triethoxyhept-5-enoate |
| SMILES | CCOC(=O)CCC/C=C/C(OCC)(OCC)OCC |
| InChI | InChI=1S/C15H28O5/c1-5-17-14(16)12-10-9-11-13-15(18-6-2,19-7-3)20-8-4/h11,13H,5-10,12H2,1-4H3/b13-11+ |
| InChIKey | WAVPQZVCVJVGCR-ACCUITESSA-N |
| XLogP | 3.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-7,7,7-triethoxyhept-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-7,7,7-triethoxyhept-5-enoate?
The IUPAC name of ethyl (E)-7,7,7-triethoxyhept-5-enoate (CID 20552418) is ethyl (E)-7,7,7-triethoxyhept-5-enoate.
What is the SMILES notation for ethyl (E)-7,7,7-triethoxyhept-5-enoate?
The canonical SMILES for ethyl (E)-7,7,7-triethoxyhept-5-enoate is CCOC(=O)CCC/C=C/C(OCC)(OCC)OCC.
What is the InChIKey of ethyl (E)-7,7,7-triethoxyhept-5-enoate?
The InChIKey is WAVPQZVCVJVGCR-ACCUITESSA-N. The full InChI is InChI=1S/C15H28O5/c1-5-17-14(16)12-10-9-11-13-15(18-6-2,19-7-3)20-8-4/h11,13H,5-10,12H2,1-4H3/b13-11+.
What are the key properties of ethyl (E)-7,7,7-triethoxyhept-5-enoate?
ethyl (E)-7,7,7-triethoxyhept-5-enoate has a molecular weight of 288.38 g/mol, XLogP of 3.04, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-7,7,7-triethoxyhept-5-enoate is sourced from PubChem (CID 20552418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).