About N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine
N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine (PubChem CID 20552436) has the molecular formula C17H35NO2
and a molecular weight of 285.47 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine.
Molecular Properties
| Compound Name | N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine |
| PubChem CID | 20552436 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine |
| SMILES | CCCCCCCC(NCC1CCCCC1)(OC)OC |
| InChI | InChI=1S/C17H35NO2/c1-4-5-6-7-11-14-17(19-2,20-3)18-15-16-12-9-8-10-13-16/h16,18H,4-15H2,1-3H3 |
| InChIKey | GWBAMQLUOPKPCA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine?
The IUPAC name of N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine (CID 20552436) is N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine.
What is the SMILES notation for N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine?
The canonical SMILES for N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine is CCCCCCCC(NCC1CCCCC1)(OC)OC.
What is the InChIKey of N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine?
The InChIKey is GWBAMQLUOPKPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2/c1-4-5-6-7-11-14-17(19-2,20-3)18-15-16-12-9-8-10-13-16/h16,18H,4-15H2,1-3H3.
What are the key properties of N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine?
N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine has a molecular weight of 285.47 g/mol, XLogP of 4.46, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyl)-1,1-dimethoxyoctan-1-amine is sourced from PubChem (CID 20552436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).