C9H11O6P — CID 20552487
(5-propan-2-yl-7,8-dioxabicyclo[4.2.0]octa-1,3,5-trien-2-yl) dihydrogen phosphate (PubChem CID 20552487) has the molecular formula C9H11O6P and a molecular weight of 246.15 g/mol. Its IUPAC name is (5-propan-2-yl-7,8-dioxabicyclo[4.2.0]octa-1,3,5-trien-2-yl) dihydrogen phosphate.
| Compound Name | (5-propan-2-yl-7,8-dioxabicyclo[4.2.0]octa-1,3,5-trien-2-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 20552487 |
| Molecular Formula | C9H11O6P |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (5-propan-2-yl-7,8-dioxabicyclo[4.2.0]octa-1,3,5-trien-2-yl) dihydrogen phosphate |
| SMILES | CC(C)c1ccc(OP(=O)(O)O)c2ooc12 |
| InChI | InChI=1S/C9H11O6P/c1-5(2)6-3-4-7(15-16(10,11)12)9-8(6)13-14-9/h3-5H,1-2H3,(H2,10,11,12) |
| InChIKey | FTMKDDXBTOFZLS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|