About 2-methylpropanal;hydrate
2-methylpropanal;hydrate (PubChem CID 20552521) has the molecular formula C4H10O2
and a molecular weight of 90.12 g/mol. Its IUPAC name is 2-methylpropanal;hydrate.
Molecular Properties
| Compound Name | 2-methylpropanal;hydrate |
| PubChem CID | 20552521 |
| Molecular Formula | C4H10O2 |
| Molecular Weight | 90.12 g/mol |
| Exact Mass | 90.07 |
| IUPAC Name | 2-methylpropanal;hydrate |
| SMILES | CC(C)C=O.O |
| InChI | InChI=1S/C4H8O.H2O/c1-4(2)3-5;/h3-4H,1-2H3;1H2 |
| InChIKey | MDSGFPFEWMAAFL-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.12 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanal;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanal;hydrate?
The IUPAC name of 2-methylpropanal;hydrate (CID 20552521) is 2-methylpropanal;hydrate.
What is the SMILES notation for 2-methylpropanal;hydrate?
The canonical SMILES for 2-methylpropanal;hydrate is CC(C)C=O.O.
What is the InChIKey of 2-methylpropanal;hydrate?
The InChIKey is MDSGFPFEWMAAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.H2O/c1-4(2)3-5;/h3-4H,1-2H3;1H2.
What are the key properties of 2-methylpropanal;hydrate?
2-methylpropanal;hydrate has a molecular weight of 90.12 g/mol, XLogP of 0.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanal;hydrate is sourced from PubChem (CID 20552521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).