ethenoxyethene;fluoromethane;sulfurofluoridic acid

C5H10F2O4S — CID 20552533

IUPACethenoxyethene;fluoromethane;sulfurofluoridic acid
SMILESC=COC=C.CF.O=S(=O)(O)F
InChIInChI=1S/C4H6O.CH3F.FHO3S/c1-3-5-4-2;1-2;1-5(2,3)4/h3-4H,1-2H2;1H3;(H,2,3,4)
InChIKeySGWDSIAKSNPSTA-UHFFFAOYSA-N
MW204.19 g/mol
LogP1.63
Rot. Bonds2

About ethenoxyethene;fluoromethane;sulfurofluoridic acid

ethenoxyethene;fluoromethane;sulfurofluoridic acid (PubChem CID 20552533) has the molecular formula C5H10F2O4S and a molecular weight of 204.19 g/mol. Its IUPAC name is ethenoxyethene;fluoromethane;sulfurofluoridic acid.

Molecular Properties

Compound Nameethenoxyethene;fluoromethane;sulfurofluoridic acid
PubChem CID20552533
Molecular FormulaC5H10F2O4S
Molecular Weight204.19 g/mol
Exact Mass204.03
IUPAC Nameethenoxyethene;fluoromethane;sulfurofluoridic acid
SMILESC=COC=C.CF.O=S(=O)(O)F
InChIInChI=1S/C4H6O.CH3F.FHO3S/c1-3-5-4-2;1-2;1-5(2,3)4/h3-4H,1-2H2;1H3;(H,2,3,4)
InChIKeySGWDSIAKSNPSTA-UHFFFAOYSA-N
XLogP1.63
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.19
LogP ≤ 51.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze ethenoxyethene;fluoromethane;sulfurofluoridic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethenoxyethene;fluoromethane;sulfurofluoridic acid?
The IUPAC name of ethenoxyethene;fluoromethane;sulfurofluoridic acid (CID 20552533) is ethenoxyethene;fluoromethane;sulfurofluoridic acid.
What is the SMILES notation for ethenoxyethene;fluoromethane;sulfurofluoridic acid?
The canonical SMILES for ethenoxyethene;fluoromethane;sulfurofluoridic acid is C=COC=C.CF.O=S(=O)(O)F.
What is the InChIKey of ethenoxyethene;fluoromethane;sulfurofluoridic acid?
The InChIKey is SGWDSIAKSNPSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O.CH3F.FHO3S/c1-3-5-4-2;1-2;1-5(2,3)4/h3-4H,1-2H2;1H3;(H,2,3,4).
What are the key properties of ethenoxyethene;fluoromethane;sulfurofluoridic acid?
ethenoxyethene;fluoromethane;sulfurofluoridic acid has a molecular weight of 204.19 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxyethene;fluoromethane;sulfurofluoridic acid is sourced from PubChem (CID 20552533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).