About 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole
7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole (PubChem CID 20553016) has the molecular formula C21H14ClN3
and a molecular weight of 343.82 g/mol. Its IUPAC name is 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole.
Molecular Properties
| Compound Name | 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole |
| PubChem CID | 20553016 |
| Molecular Formula | C21H14ClN3 |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole |
| SMILES | Clc1ccc2c(c1)Cn1nc(-c3ccc(-c4ccccc4)cc3)nc1-2 |
| InChI | InChI=1S/C21H14ClN3/c22-18-10-11-19-17(12-18)13-25-21(19)23-20(24-25)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-12H,13H2 |
| InChIKey | PXSQTCFEILGJBG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole?
The IUPAC name of 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole (CID 20553016) is 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole.
What is the SMILES notation for 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole?
The canonical SMILES for 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole is Clc1ccc2c(c1)Cn1nc(-c3ccc(-c4ccccc4)cc3)nc1-2.
What is the InChIKey of 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole?
The InChIKey is PXSQTCFEILGJBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14ClN3/c22-18-10-11-19-17(12-18)13-25-21(19)23-20(24-25)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-12H,13H2.
What are the key properties of 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole?
7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole has a molecular weight of 343.82 g/mol, XLogP of 5.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-(4-phenylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole is sourced from PubChem (CID 20553016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).