About 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene
4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene (PubChem CID 20553350) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene.
Molecular Properties
| Compound Name | 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene |
| PubChem CID | 20553350 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene |
| SMILES | C=CCC(CC=C)C(CC=C)(CC=C)OCC |
| InChI | InChI=1S/C16H26O/c1-6-11-15(12-7-2)16(13-8-3,14-9-4)17-10-5/h6-9,15H,1-4,10-14H2,5H3 |
| InChIKey | FJSHLMOKXQNYMF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene?
The IUPAC name of 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene (CID 20553350) is 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene.
What is the SMILES notation for 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene?
The canonical SMILES for 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene is C=CCC(CC=C)C(CC=C)(CC=C)OCC.
What is the InChIKey of 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene?
The InChIKey is FJSHLMOKXQNYMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O/c1-6-11-15(12-7-2)16(13-8-3,14-9-4)17-10-5/h6-9,15H,1-4,10-14H2,5H3.
What are the key properties of 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene?
4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene has a molecular weight of 234.38 g/mol, XLogP of 4.68, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-4,5-bis(prop-2-enyl)octa-1,7-diene is sourced from PubChem (CID 20553350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).