About 3-(ethoxymethyl)-2,3-dimethylindole
3-(ethoxymethyl)-2,3-dimethylindole (PubChem CID 20553391) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-(ethoxymethyl)-2,3-dimethylindole.
Molecular Properties
| Compound Name | 3-(ethoxymethyl)-2,3-dimethylindole |
| PubChem CID | 20553391 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-(ethoxymethyl)-2,3-dimethylindole |
| SMILES | CCOCC1(C)C(C)=Nc2ccccc21 |
| InChI | InChI=1S/C13H17NO/c1-4-15-9-13(3)10(2)14-12-8-6-5-7-11(12)13/h5-8H,4,9H2,1-3H3 |
| InChIKey | RZSYTKMIJYAIER-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(ethoxymethyl)-2,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethoxymethyl)-2,3-dimethylindole?
The IUPAC name of 3-(ethoxymethyl)-2,3-dimethylindole (CID 20553391) is 3-(ethoxymethyl)-2,3-dimethylindole.
What is the SMILES notation for 3-(ethoxymethyl)-2,3-dimethylindole?
The canonical SMILES for 3-(ethoxymethyl)-2,3-dimethylindole is CCOCC1(C)C(C)=Nc2ccccc21.
What is the InChIKey of 3-(ethoxymethyl)-2,3-dimethylindole?
The InChIKey is RZSYTKMIJYAIER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-4-15-9-13(3)10(2)14-12-8-6-5-7-11(12)13/h5-8H,4,9H2,1-3H3.
What are the key properties of 3-(ethoxymethyl)-2,3-dimethylindole?
3-(ethoxymethyl)-2,3-dimethylindole has a molecular weight of 203.28 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethoxymethyl)-2,3-dimethylindole is sourced from PubChem (CID 20553391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).