About 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine
4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine (PubChem CID 20553458) has the molecular formula C29H37Cl2N3O2
and a molecular weight of 530.54 g/mol. Its IUPAC name is 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine.
Molecular Properties
| Compound Name | 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine |
| PubChem CID | 20553458 |
| Molecular Formula | C29H37Cl2N3O2 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine |
| SMILES | Clc1c(OCCCN2CCCCC2)ccc2cc3ccc(OCCCN4CCCCC4)c(Cl)c3nc12 |
| InChI | InChI=1S/C29H37Cl2N3O2/c30-26-24(35-19-7-17-33-13-3-1-4-14-33)11-9-22-21-23-10-12-25(27(31)29(23)32-28(22)26)36-20-8-18-34-15-5-2-6-16-34/h9-12,21H,1-8,13-20H2 |
| InChIKey | IEBBBTWYFONAJO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine?
The IUPAC name of 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine (CID 20553458) is 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine.
What is the SMILES notation for 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine?
The canonical SMILES for 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine is Clc1c(OCCCN2CCCCC2)ccc2cc3ccc(OCCCN4CCCCC4)c(Cl)c3nc12.
What is the InChIKey of 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine?
The InChIKey is IEBBBTWYFONAJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H37Cl2N3O2/c30-26-24(35-19-7-17-33-13-3-1-4-14-33)11-9-22-21-23-10-12-25(27(31)29(23)32-28(22)26)36-20-8-18-34-15-5-2-6-16-34/h9-12,21H,1-8,13-20H2.
What are the key properties of 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine?
4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine has a molecular weight of 530.54 g/mol, XLogP of 7.20, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-3,6-bis(3-piperidin-1-ylpropoxy)acridine is sourced from PubChem (CID 20553458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).