About 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine
2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine (PubChem CID 20553463) has the molecular formula C25H33Cl2N3O2
and a molecular weight of 478.46 g/mol. Its IUPAC name is 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine |
| PubChem CID | 20553463 |
| Molecular Formula | C25H33Cl2N3O2 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc2cc3ccc(OCCN(CC)CC)c(Cl)c3nc2c1Cl |
| InChI | InChI=1S/C25H33Cl2N3O2/c1-5-29(6-2)13-15-31-20-11-9-18-17-19-10-12-21(32-16-14-30(7-3)8-4)23(27)25(19)28-24(18)22(20)26/h9-12,17H,5-8,13-16H2,1-4H3 |
| InChIKey | KBRYAUAQFKOQFH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine?
The IUPAC name of 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine (CID 20553463) is 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine.
What is the SMILES notation for 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine?
The canonical SMILES for 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine is CCN(CC)CCOc1ccc2cc3ccc(OCCN(CC)CC)c(Cl)c3nc2c1Cl.
What is the InChIKey of 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine?
The InChIKey is KBRYAUAQFKOQFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33Cl2N3O2/c1-5-29(6-2)13-15-31-20-11-9-18-17-19-10-12-21(32-16-14-30(7-3)8-4)23(27)25(19)28-24(18)22(20)26/h9-12,17H,5-8,13-16H2,1-4H3.
What are the key properties of 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine?
2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine has a molecular weight of 478.46 g/mol, XLogP of 6.14, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-dichloro-6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine is sourced from PubChem (CID 20553463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).