About 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol
2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol (PubChem CID 20553842) has the molecular formula C10H14ClNO2
and a molecular weight of 215.68 g/mol. Its IUPAC name is 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol.
Molecular Properties
| Compound Name | 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol |
| PubChem CID | 20553842 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol |
| SMILES | Cc1c(C)c(Cl)c(O)c(CNO)c1C |
| InChI | InChI=1S/C10H14ClNO2/c1-5-6(2)8(4-12-14)10(13)9(11)7(5)3/h12-14H,4H2,1-3H3 |
| InChIKey | HWTQNKWLXVPIGX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol?
The IUPAC name of 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol (CID 20553842) is 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol.
What is the SMILES notation for 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol?
The canonical SMILES for 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol is Cc1c(C)c(Cl)c(O)c(CNO)c1C.
What is the InChIKey of 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol?
The InChIKey is HWTQNKWLXVPIGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO2/c1-5-6(2)8(4-12-14)10(13)9(11)7(5)3/h12-14H,4H2,1-3H3.
What are the key properties of 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol?
2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol has a molecular weight of 215.68 g/mol, XLogP of 2.45, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-[(hydroxyamino)methyl]-3,4,5-trimethylphenol is sourced from PubChem (CID 20553842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).