About 1H-imidazole;phthalic acid;hydrate
1H-imidazole;phthalic acid;hydrate (PubChem CID 20553876) has the molecular formula C11H12N2O5
and a molecular weight of 252.23 g/mol. Its IUPAC name is 1H-imidazole;phthalic acid;hydrate.
Molecular Properties
| Compound Name | 1H-imidazole;phthalic acid;hydrate |
| PubChem CID | 20553876 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1H-imidazole;phthalic acid;hydrate |
| SMILES | O.O=C(O)c1ccccc1C(=O)O.c1c[nH]cn1 |
| InChI | InChI=1S/C8H6O4.C3H4N2.H2O/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-2-5-3-4-1;/h1-4H,(H,9,10)(H,11,12);1-3H,(H,4,5);1H2 |
| InChIKey | NMOBOEZRKPHXBZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-imidazole;phthalic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;phthalic acid;hydrate?
The IUPAC name of 1H-imidazole;phthalic acid;hydrate (CID 20553876) is 1H-imidazole;phthalic acid;hydrate.
What is the SMILES notation for 1H-imidazole;phthalic acid;hydrate?
The canonical SMILES for 1H-imidazole;phthalic acid;hydrate is O.O=C(O)c1ccccc1C(=O)O.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;phthalic acid;hydrate?
The InChIKey is NMOBOEZRKPHXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C3H4N2.H2O/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-2-5-3-4-1;/h1-4H,(H,9,10)(H,11,12);1-3H,(H,4,5);1H2.
What are the key properties of 1H-imidazole;phthalic acid;hydrate?
1H-imidazole;phthalic acid;hydrate has a molecular weight of 252.23 g/mol, XLogP of 0.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;phthalic acid;hydrate is sourced from PubChem (CID 20553876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).