About 4-chlorophenol;3,5-dibromophenol
4-chlorophenol;3,5-dibromophenol (PubChem CID 20553878) has the molecular formula C12H9Br2ClO2
and a molecular weight of 380.46 g/mol. Its IUPAC name is 4-chlorophenol;3,5-dibromophenol.
Molecular Properties
| Compound Name | 4-chlorophenol;3,5-dibromophenol |
| PubChem CID | 20553878 |
| Molecular Formula | C12H9Br2ClO2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 377.87 |
| IUPAC Name | 4-chlorophenol;3,5-dibromophenol |
| SMILES | Oc1cc(Br)cc(Br)c1.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H4Br2O.C6H5ClO/c7-4-1-5(8)3-6(9)2-4;7-5-1-3-6(8)4-2-5/h1-3,9H;1-4,8H |
| InChIKey | MFUHBXZIZGMUNT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chlorophenol;3,5-dibromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorophenol;3,5-dibromophenol?
The IUPAC name of 4-chlorophenol;3,5-dibromophenol (CID 20553878) is 4-chlorophenol;3,5-dibromophenol.
What is the SMILES notation for 4-chlorophenol;3,5-dibromophenol?
The canonical SMILES for 4-chlorophenol;3,5-dibromophenol is Oc1cc(Br)cc(Br)c1.Oc1ccc(Cl)cc1.
What is the InChIKey of 4-chlorophenol;3,5-dibromophenol?
The InChIKey is MFUHBXZIZGMUNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br2O.C6H5ClO/c7-4-1-5(8)3-6(9)2-4;7-5-1-3-6(8)4-2-5/h1-3,9H;1-4,8H.
What are the key properties of 4-chlorophenol;3,5-dibromophenol?
4-chlorophenol;3,5-dibromophenol has a molecular weight of 380.46 g/mol, XLogP of 4.96, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorophenol;3,5-dibromophenol is sourced from PubChem (CID 20553878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).