C14H19NO5S — CID 20554184
2-(2,2-dimethyl-3-sulfanylpropanoyl)-6,9-dioxo-2-azaspiro[4.4]nonane-3-carboxylic acid (PubChem CID 20554184) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3-sulfanylpropanoyl)-6,9-dioxo-2-azaspiro[4.4]nonane-3-carboxylic acid.
| Compound Name | 2-(2,2-dimethyl-3-sulfanylpropanoyl)-6,9-dioxo-2-azaspiro[4.4]nonane-3-carboxylic acid |
|---|---|
| PubChem CID | 20554184 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-(2,2-dimethyl-3-sulfanylpropanoyl)-6,9-dioxo-2-azaspiro[4.4]nonane-3-carboxylic acid |
| SMILES | CC(C)(CS)C(=O)N1CC2(CC1C(=O)O)C(=O)CCC2=O |
| InChI | InChI=1S/C14H19NO5S/c1-13(2,7-21)12(20)15-6-14(5-8(15)11(18)19)9(16)3-4-10(14)17/h8,21H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | LHEKVCWTYXYPGE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|