C14H22N2 — CID 20554698
5-prop-2-enyl-3,4,4a,5,5a,6,7,8,8a,9-decahydro-2H-pyrrolo[3,4-g]quinoline (PubChem CID 20554698) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 5-prop-2-enyl-3,4,4a,5,5a,6,7,8,8a,9-decahydro-2H-pyrrolo[3,4-g]quinoline.
| Compound Name | 5-prop-2-enyl-3,4,4a,5,5a,6,7,8,8a,9-decahydro-2H-pyrrolo[3,4-g]quinoline |
|---|---|
| PubChem CID | 20554698 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 5-prop-2-enyl-3,4,4a,5,5a,6,7,8,8a,9-decahydro-2H-pyrrolo[3,4-g]quinoline |
| SMILES | C=CCC1C2CCCN=C2CC2CNCC21 |
| InChI | InChI=1S/C14H22N2/c1-2-4-11-12-5-3-6-16-14(12)7-10-8-15-9-13(10)11/h2,10-13,15H,1,3-9H2 |
| InChIKey | ZARMWZAEAAYHGN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|