About benzimidazol-2-one;hydrochloride
benzimidazol-2-one;hydrochloride (PubChem CID 20555078) has the molecular formula C7H5ClN2O
and a molecular weight of 168.58 g/mol. Its IUPAC name is benzimidazol-2-one;hydrochloride.
Molecular Properties
| Compound Name | benzimidazol-2-one;hydrochloride |
| PubChem CID | 20555078 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | benzimidazol-2-one;hydrochloride |
| SMILES | Cl.O=C1N=c2ccccc2=N1 |
| InChI | InChI=1S/C7H4N2O.ClH/c10-7-8-5-3-1-2-4-6(5)9-7;/h1-4H;1H |
| InChIKey | QUNGXSCIAYPUKE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzimidazol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzimidazol-2-one;hydrochloride?
The IUPAC name of benzimidazol-2-one;hydrochloride (CID 20555078) is benzimidazol-2-one;hydrochloride.
What is the SMILES notation for benzimidazol-2-one;hydrochloride?
The canonical SMILES for benzimidazol-2-one;hydrochloride is Cl.O=C1N=c2ccccc2=N1.
What is the InChIKey of benzimidazol-2-one;hydrochloride?
The InChIKey is QUNGXSCIAYPUKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O.ClH/c10-7-8-5-3-1-2-4-6(5)9-7;/h1-4H;1H.
What are the key properties of benzimidazol-2-one;hydrochloride?
benzimidazol-2-one;hydrochloride has a molecular weight of 168.58 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzimidazol-2-one;hydrochloride is sourced from PubChem (CID 20555078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).